C17H24N6O — CID 119394617
2-methyl-N-(3-piperazin-1-ylpropyl)-4-(1,2,4-triazol-1-yl)benzamide (PubChem CID 119394617) has the molecular formula C17H24N6O and a molecular weight of 328.42 g/mol. Its IUPAC name is 2-methyl-N-(3-piperazin-1-ylpropyl)-4-(1,2,4-triazol-1-yl)benzamide.
| Compound Name | 2-methyl-N-(3-piperazin-1-ylpropyl)-4-(1,2,4-triazol-1-yl)benzamide |
|---|---|
| PubChem CID | 119394617 |
| Molecular Formula | C17H24N6O |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | 2-methyl-N-(3-piperazin-1-ylpropyl)-4-(1,2,4-triazol-1-yl)benzamide |
| SMILES | Cc1cc(-n2cncn2)ccc1C(=O)NCCCN1CCNCC1 |
| InChI | InChI=1S/C17H24N6O/c1-14-11-15(23-13-19-12-21-23)3-4-16(14)17(24)20-5-2-8-22-9-6-18-7-10-22/h3-4,11-13,18H,2,5-10H2,1H3,(H,20,24) |
| InChIKey | YHURIOZFTHTMOH-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|