C14H23ClF3N3O2 — CID 119398245
3-[3-(methylaminomethyl)piperidine-1-carbonyl]-6-(trifluoromethyl)piperidin-2-one;hydrochloride (PubChem CID 119398245) has the molecular formula C14H23ClF3N3O2 and a molecular weight of 357.80 g/mol. Its IUPAC name is 3-[3-(methylaminomethyl)piperidine-1-carbonyl]-6-(trifluoromethyl)piperidin-2-one;hydrochloride.
| Compound Name | 3-[3-(methylaminomethyl)piperidine-1-carbonyl]-6-(trifluoromethyl)piperidin-2-one;hydrochloride |
|---|---|
| PubChem CID | 119398245 |
| Molecular Formula | C14H23ClF3N3O2 |
| Molecular Weight | 357.80 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 3-[3-(methylaminomethyl)piperidine-1-carbonyl]-6-(trifluoromethyl)piperidin-2-one;hydrochloride |
| SMILES | CNCC1CCCN(C(=O)C2CCC(C(F)(F)F)NC2=O)C1.Cl |
| InChI | InChI=1S/C14H22F3N3O2.ClH/c1-18-7-9-3-2-6-20(8-9)13(22)10-4-5-11(14(15,16)17)19-12(10)21;/h9-11,18H,2-8H2,1H3,(H,19,21);1H |
| InChIKey | GOSRGCDTCNNJRU-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.80 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|