C11H16F3N3O2 — CID 124610953
(3S,6R)-3-[(3R)-3-aminopyrrolidine-1-carbonyl]-6-(trifluoromethyl)piperidin-2-one (PubChem CID 124610953) has the molecular formula C11H16F3N3O2 and a molecular weight of 279.26 g/mol. Its IUPAC name is (3S,6R)-3-[(3R)-3-aminopyrrolidine-1-carbonyl]-6-(trifluoromethyl)piperidin-2-one.
| Compound Name | (3S,6R)-3-[(3R)-3-aminopyrrolidine-1-carbonyl]-6-(trifluoromethyl)piperidin-2-one |
|---|---|
| PubChem CID | 124610953 |
| Molecular Formula | C11H16F3N3O2 |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | (3S,6R)-3-[(3R)-3-aminopyrrolidine-1-carbonyl]-6-(trifluoromethyl)piperidin-2-one |
| SMILES | N[C@@H]1CCN(C(=O)[C@H]2CC[C@H](C(F)(F)F)NC2=O)C1 |
| InChI | InChI=1S/C11H16F3N3O2/c12-11(13,14)8-2-1-7(9(18)16-8)10(19)17-4-3-6(15)5-17/h6-8H,1-5,15H2,(H,16,18)/t6-,7+,8-/m1/s1 |
| InChIKey | HJWPCGNRQAKOHE-GJMOJQLCSA-N |
| XLogP | 0.00 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|