C20H25F3N2O2 — CID 166367931
3-[4-(3,5-dimethylphenyl)piperidine-1-carbonyl]-6-(trifluoromethyl)piperidin-2-one (PubChem CID 166367931) has the molecular formula C20H25F3N2O2 and a molecular weight of 382.43 g/mol. Its IUPAC name is 3-[4-(3,5-dimethylphenyl)piperidine-1-carbonyl]-6-(trifluoromethyl)piperidin-2-one.
| Compound Name | 3-[4-(3,5-dimethylphenyl)piperidine-1-carbonyl]-6-(trifluoromethyl)piperidin-2-one |
|---|---|
| PubChem CID | 166367931 |
| Molecular Formula | C20H25F3N2O2 |
| Molecular Weight | 382.43 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 3-[4-(3,5-dimethylphenyl)piperidine-1-carbonyl]-6-(trifluoromethyl)piperidin-2-one |
| SMILES | Cc1cc(C)cc(C2CCN(C(=O)C3CCC(C(F)(F)F)NC3=O)CC2)c1 |
| InChI | InChI=1S/C20H25F3N2O2/c1-12-9-13(2)11-15(10-12)14-5-7-25(8-6-14)19(27)16-3-4-17(20(21,22)23)24-18(16)26/h9-11,14,16-17H,3-8H2,1-2H3,(H,24,26) |
| InChIKey | XOSCSCZSZDLXLE-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.43 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|