C12H15F3N2O4 — CID 129425361
(3R)-1-[(3R,6S)-2-oxo-6-(trifluoromethyl)piperidine-3-carbonyl]pyrrolidine-3-carboxylic acid (PubChem CID 129425361) has the molecular formula C12H15F3N2O4 and a molecular weight of 308.26 g/mol. Its IUPAC name is (3R)-1-[(3R,6S)-2-oxo-6-(trifluoromethyl)piperidine-3-carbonyl]pyrrolidine-3-carboxylic acid.
| Compound Name | (3R)-1-[(3R,6S)-2-oxo-6-(trifluoromethyl)piperidine-3-carbonyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 129425361 |
| Molecular Formula | C12H15F3N2O4 |
| Molecular Weight | 308.26 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | (3R)-1-[(3R,6S)-2-oxo-6-(trifluoromethyl)piperidine-3-carbonyl]pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCN(C(=O)[C@@H]2CC[C@@H](C(F)(F)F)NC2=O)C1 |
| InChI | InChI=1S/C12H15F3N2O4/c13-12(14,15)8-2-1-7(9(18)16-8)10(19)17-4-3-6(5-17)11(20)21/h6-8H,1-5H2,(H,16,18)(H,20,21)/t6-,7-,8+/m1/s1 |
| InChIKey | HDFKIUSIWBQUNW-PRJMDXOYSA-N |
| XLogP | 0.38 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.26 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|