C16H18Cl2N2OS — CID 119400371
[5-(3-chlorophenyl)-4-methylthiophen-2-yl]-piperazin-1-ylmethanone;hydrochloride (PubChem CID 119400371) has the molecular formula C16H18Cl2N2OS and a molecular weight of 357.31 g/mol. Its IUPAC name is [5-(3-chlorophenyl)-4-methylthiophen-2-yl]-piperazin-1-ylmethanone;hydrochloride.
| Compound Name | [5-(3-chlorophenyl)-4-methylthiophen-2-yl]-piperazin-1-ylmethanone;hydrochloride |
|---|---|
| PubChem CID | 119400371 |
| Molecular Formula | C16H18Cl2N2OS |
| Molecular Weight | 357.31 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | [5-(3-chlorophenyl)-4-methylthiophen-2-yl]-piperazin-1-ylmethanone;hydrochloride |
| SMILES | Cc1cc(C(=O)N2CCNCC2)sc1-c1cccc(Cl)c1.Cl |
| InChI | InChI=1S/C16H17ClN2OS.ClH/c1-11-9-14(16(20)19-7-5-18-6-8-19)21-15(11)12-3-2-4-13(17)10-12;/h2-4,9-10,18H,5-8H2,1H3;1H |
| InChIKey | DDCPVQORJWWJAA-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.31 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |