C10H15ClN2OS2 — CID 119400398
(3-methylsulfanylthiophen-2-yl)-piperazin-1-ylmethanone;hydrochloride (PubChem CID 119400398) has the molecular formula C10H15ClN2OS2 and a molecular weight of 278.83 g/mol. Its IUPAC name is (3-methylsulfanylthiophen-2-yl)-piperazin-1-ylmethanone;hydrochloride.
| Compound Name | (3-methylsulfanylthiophen-2-yl)-piperazin-1-ylmethanone;hydrochloride |
|---|---|
| PubChem CID | 119400398 |
| Molecular Formula | C10H15ClN2OS2 |
| Molecular Weight | 278.83 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | (3-methylsulfanylthiophen-2-yl)-piperazin-1-ylmethanone;hydrochloride |
| SMILES | CSc1ccsc1C(=O)N1CCNCC1.Cl |
| InChI | InChI=1S/C10H14N2OS2.ClH/c1-14-8-2-7-15-9(8)10(13)12-5-3-11-4-6-12;/h2,7,11H,3-6H2,1H3;1H |
| InChIKey | YEDQAAWXMDPYLB-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.83 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |