C11H13F2NOS2 — CID 71932339
[3-(difluoromethylsulfanyl)thiophen-2-yl]-piperidin-1-ylmethanone (PubChem CID 71932339) has the molecular formula C11H13F2NOS2 and a molecular weight of 277.36 g/mol. Its IUPAC name is [3-(difluoromethylsulfanyl)thiophen-2-yl]-piperidin-1-ylmethanone.
| Compound Name | [3-(difluoromethylsulfanyl)thiophen-2-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 71932339 |
| Molecular Formula | C11H13F2NOS2 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | [3-(difluoromethylsulfanyl)thiophen-2-yl]-piperidin-1-ylmethanone |
| SMILES | O=C(c1sccc1SC(F)F)N1CCCCC1 |
| InChI | InChI=1S/C11H13F2NOS2/c12-11(13)17-8-4-7-16-9(8)10(15)14-5-2-1-3-6-14/h4,7,11H,1-3,5-6H2 |
| InChIKey | QIANCGRPGJFDFG-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |