C12H19ClN2OS2 — CID 119488013
[3-(methylamino)piperidin-1-yl]-(3-methylsulfanylthiophen-2-yl)methanone;hydrochloride (PubChem CID 119488013) has the molecular formula C12H19ClN2OS2 and a molecular weight of 306.88 g/mol. Its IUPAC name is [3-(methylamino)piperidin-1-yl]-(3-methylsulfanylthiophen-2-yl)methanone;hydrochloride.
| Compound Name | [3-(methylamino)piperidin-1-yl]-(3-methylsulfanylthiophen-2-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119488013 |
| Molecular Formula | C12H19ClN2OS2 |
| Molecular Weight | 306.88 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | [3-(methylamino)piperidin-1-yl]-(3-methylsulfanylthiophen-2-yl)methanone;hydrochloride |
| SMILES | CNC1CCCN(C(=O)c2sccc2SC)C1.Cl |
| InChI | InChI=1S/C12H18N2OS2.ClH/c1-13-9-4-3-6-14(8-9)12(15)11-10(16-2)5-7-17-11;/h5,7,9,13H,3-4,6,8H2,1-2H3;1H |
| InChIKey | MIZHRJDDSJFVDT-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.88 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |