C19H23N3O4S — CID 11940175
N-[(Z)-[5-[(1R,2S)-2-methylcyclopropyl]furan-2-yl]methylideneamino]-2-[methyl-(4-methylphenyl)sulfonylamino]acetamide (PubChem CID 11940175) has the molecular formula C19H23N3O4S and a molecular weight of 389.48 g/mol. Its IUPAC name is N-[(Z)-[5-[(1R,2S)-2-methylcyclopropyl]furan-2-yl]methylideneamino]-2-[methyl-(4-methylphenyl)sulfonylamino]acetamide.
| Compound Name | N-[(Z)-[5-[(1R,2S)-2-methylcyclopropyl]furan-2-yl]methylideneamino]-2-[methyl-(4-methylphenyl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 11940175 |
| Molecular Formula | C19H23N3O4S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | N-[(Z)-[5-[(1R,2S)-2-methylcyclopropyl]furan-2-yl]methylideneamino]-2-[methyl-(4-methylphenyl)sulfonylamino]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)CC(=O)N/N=C\c2ccc([C@@H]3C[C@@H]3C)o2)cc1 |
| InChI | InChI=1S/C19H23N3O4S/c1-13-4-7-16(8-5-13)27(24,25)22(3)12-19(23)21-20-11-15-6-9-18(26-15)17-10-14(17)2/h4-9,11,14,17H,10,12H2,1-3H3,(H,21,23)/b20-11-/t14-,17+/m0/s1 |
| InChIKey | FYYGHTGIWORZCZ-YASQXWSASA-N |
| XLogP | 2.48 |
| TPSA | 91.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|