C13H14ClF4N5O — CID 119407882
N-(3-aminopropyl)-1-(2-fluorophenyl)-5-(trifluoromethyl)triazole-4-carboxamide;hydrochloride (PubChem CID 119407882) has the molecular formula C13H14ClF4N5O and a molecular weight of 367.73 g/mol. Its IUPAC name is N-(3-aminopropyl)-1-(2-fluorophenyl)-5-(trifluoromethyl)triazole-4-carboxamide;hydrochloride.
| Compound Name | N-(3-aminopropyl)-1-(2-fluorophenyl)-5-(trifluoromethyl)triazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119407882 |
| Molecular Formula | C13H14ClF4N5O |
| Molecular Weight | 367.73 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | N-(3-aminopropyl)-1-(2-fluorophenyl)-5-(trifluoromethyl)triazole-4-carboxamide;hydrochloride |
| SMILES | Cl.NCCCNC(=O)c1nnn(-c2ccccc2F)c1C(F)(F)F |
| InChI | InChI=1S/C13H13F4N5O.ClH/c14-8-4-1-2-5-9(8)22-11(13(15,16)17)10(20-21-22)12(23)19-7-3-6-18;/h1-2,4-5H,3,6-7,18H2,(H,19,23);1H |
| InChIKey | ITTMLPAUCJFXSL-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.73 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|