C16H17F4N5O — CID 120573418
1-(2-fluorophenyl)-N-(2-methylpiperidin-3-yl)-5-(trifluoromethyl)triazole-4-carboxamide (PubChem CID 120573418) has the molecular formula C16H17F4N5O and a molecular weight of 371.34 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-N-(2-methylpiperidin-3-yl)-5-(trifluoromethyl)triazole-4-carboxamide.
| Compound Name | 1-(2-fluorophenyl)-N-(2-methylpiperidin-3-yl)-5-(trifluoromethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 120573418 |
| Molecular Formula | C16H17F4N5O |
| Molecular Weight | 371.34 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 1-(2-fluorophenyl)-N-(2-methylpiperidin-3-yl)-5-(trifluoromethyl)triazole-4-carboxamide |
| SMILES | CC1NCCCC1NC(=O)c1nnn(-c2ccccc2F)c1C(F)(F)F |
| InChI | InChI=1S/C16H17F4N5O/c1-9-11(6-4-8-21-9)22-15(26)13-14(16(18,19)20)25(24-23-13)12-7-3-2-5-10(12)17/h2-3,5,7,9,11,21H,4,6,8H2,1H3,(H,22,26) |
| InChIKey | KDGWRGXTEXJMBX-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.34 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |