C14H15F4N5O — CID 119629360
N-(2-amino-2-methylpropyl)-1-(2-fluorophenyl)-5-(trifluoromethyl)triazole-4-carboxamide (PubChem CID 119629360) has the molecular formula C14H15F4N5O and a molecular weight of 345.30 g/mol. Its IUPAC name is N-(2-amino-2-methylpropyl)-1-(2-fluorophenyl)-5-(trifluoromethyl)triazole-4-carboxamide.
| Compound Name | N-(2-amino-2-methylpropyl)-1-(2-fluorophenyl)-5-(trifluoromethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 119629360 |
| Molecular Formula | C14H15F4N5O |
| Molecular Weight | 345.30 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | N-(2-amino-2-methylpropyl)-1-(2-fluorophenyl)-5-(trifluoromethyl)triazole-4-carboxamide |
| SMILES | CC(C)(N)CNC(=O)c1nnn(-c2ccccc2F)c1C(F)(F)F |
| InChI | InChI=1S/C14H15F4N5O/c1-13(2,19)7-20-12(24)10-11(14(16,17)18)23(22-21-10)9-6-4-3-5-8(9)15/h3-6H,7,19H2,1-2H3,(H,20,24) |
| InChIKey | CHYZJXRZTJOWFE-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.30 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |