C15H17ClN4O4 — CID 119417546
4-(1,4-diazepane-1-carbonyl)-6-nitro-1H-quinolin-2-one;hydrochloride (PubChem CID 119417546) has the molecular formula C15H17ClN4O4 and a molecular weight of 352.78 g/mol. Its IUPAC name is 4-(1,4-diazepane-1-carbonyl)-6-nitro-1H-quinolin-2-one;hydrochloride.
| Compound Name | 4-(1,4-diazepane-1-carbonyl)-6-nitro-1H-quinolin-2-one;hydrochloride |
|---|---|
| PubChem CID | 119417546 |
| Molecular Formula | C15H17ClN4O4 |
| Molecular Weight | 352.78 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 4-(1,4-diazepane-1-carbonyl)-6-nitro-1H-quinolin-2-one;hydrochloride |
| SMILES | Cl.O=C(c1cc(=O)[nH]c2ccc([N+](=O)[O-])cc12)N1CCCNCC1 |
| InChI | InChI=1S/C15H16N4O4.ClH/c20-14-9-12(15(21)18-6-1-4-16-5-7-18)11-8-10(19(22)23)2-3-13(11)17-14;/h2-3,8-9,16H,1,4-7H2,(H,17,20);1H |
| InChIKey | YEMMIFBMCAPZTD-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 108.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.78 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|