C18H24ClN3O4S — CID 119419750
N-(3-amino-4-methoxyphenyl)-3-[methyl(propan-2-yl)sulfamoyl]benzamide;hydrochloride (PubChem CID 119419750) has the molecular formula C18H24ClN3O4S and a molecular weight of 413.93 g/mol. Its IUPAC name is N-(3-amino-4-methoxyphenyl)-3-[methyl(propan-2-yl)sulfamoyl]benzamide;hydrochloride.
| Compound Name | N-(3-amino-4-methoxyphenyl)-3-[methyl(propan-2-yl)sulfamoyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 119419750 |
| Molecular Formula | C18H24ClN3O4S |
| Molecular Weight | 413.93 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | N-(3-amino-4-methoxyphenyl)-3-[methyl(propan-2-yl)sulfamoyl]benzamide;hydrochloride |
| SMILES | COc1ccc(NC(=O)c2cccc(S(=O)(=O)N(C)C(C)C)c2)cc1N.Cl |
| InChI | InChI=1S/C18H23N3O4S.ClH/c1-12(2)21(3)26(23,24)15-7-5-6-13(10-15)18(22)20-14-8-9-17(25-4)16(19)11-14;/h5-12H,19H2,1-4H3,(H,20,22);1H |
| InChIKey | HGPVFDHKTTXKOU-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.93 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|