C14H23Cl2N3O3 — CID 119419896
N-(3-amino-4-methoxyphenyl)-4-ethylmorpholine-2-carboxamide;dihydrochloride (PubChem CID 119419896) has the molecular formula C14H23Cl2N3O3 and a molecular weight of 352.26 g/mol. Its IUPAC name is N-(3-amino-4-methoxyphenyl)-4-ethylmorpholine-2-carboxamide;dihydrochloride.
| Compound Name | N-(3-amino-4-methoxyphenyl)-4-ethylmorpholine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119419896 |
| Molecular Formula | C14H23Cl2N3O3 |
| Molecular Weight | 352.26 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | N-(3-amino-4-methoxyphenyl)-4-ethylmorpholine-2-carboxamide;dihydrochloride |
| SMILES | CCN1CCOC(C(=O)Nc2ccc(OC)c(N)c2)C1.Cl.Cl |
| InChI | InChI=1S/C14H21N3O3.2ClH/c1-3-17-6-7-20-13(9-17)14(18)16-10-4-5-12(19-2)11(15)8-10;;/h4-5,8,13H,3,6-7,9,15H2,1-2H3,(H,16,18);2*1H |
| InChIKey | KERMQMLJBYSKFK-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.26 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|