C19H22ClN3O3 — CID 119420415
N-(3-amino-4-methoxyphenyl)-2-[cyclopropanecarbonyl(methyl)amino]benzamide;hydrochloride (PubChem CID 119420415) has the molecular formula C19H22ClN3O3 and a molecular weight of 375.86 g/mol. Its IUPAC name is N-(3-amino-4-methoxyphenyl)-2-[cyclopropanecarbonyl(methyl)amino]benzamide;hydrochloride.
| Compound Name | N-(3-amino-4-methoxyphenyl)-2-[cyclopropanecarbonyl(methyl)amino]benzamide;hydrochloride |
|---|---|
| PubChem CID | 119420415 |
| Molecular Formula | C19H22ClN3O3 |
| Molecular Weight | 375.86 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | N-(3-amino-4-methoxyphenyl)-2-[cyclopropanecarbonyl(methyl)amino]benzamide;hydrochloride |
| SMILES | COc1ccc(NC(=O)c2ccccc2N(C)C(=O)C2CC2)cc1N.Cl |
| InChI | InChI=1S/C19H21N3O3.ClH/c1-22(19(24)12-7-8-12)16-6-4-3-5-14(16)18(23)21-13-9-10-17(25-2)15(20)11-13;/h3-6,9-12H,7-8,20H2,1-2H3,(H,21,23);1H |
| InChIKey | HXYAHAZURLKASP-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.86 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|