C15H21Cl2N3OS — CID 119422829
N-(2-aminophenyl)-2-(2-tert-butyl-1,3-thiazol-4-yl)acetamide;dihydrochloride (PubChem CID 119422829) has the molecular formula C15H21Cl2N3OS and a molecular weight of 362.33 g/mol. Its IUPAC name is N-(2-aminophenyl)-2-(2-tert-butyl-1,3-thiazol-4-yl)acetamide;dihydrochloride.
| Compound Name | N-(2-aminophenyl)-2-(2-tert-butyl-1,3-thiazol-4-yl)acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119422829 |
| Molecular Formula | C15H21Cl2N3OS |
| Molecular Weight | 362.33 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | N-(2-aminophenyl)-2-(2-tert-butyl-1,3-thiazol-4-yl)acetamide;dihydrochloride |
| SMILES | CC(C)(C)c1nc(CC(=O)Nc2ccccc2N)cs1.Cl.Cl |
| InChI | InChI=1S/C15H19N3OS.2ClH/c1-15(2,3)14-17-10(9-20-14)8-13(19)18-12-7-5-4-6-11(12)16;;/h4-7,9H,8,16H2,1-3H3,(H,18,19);2*1H |
| InChIKey | PBVIFTLBMLYMKR-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.33 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|