About N-(2-aminophenyl)-2-(2-tert-butyl-1,3-thiazol-4-yl)acetamide;dihydrochloride
N-(2-aminophenyl)-2-(2-tert-butyl-1,3-thiazol-4-yl)acetamide;dihydrochloride (PubChem CID 119422829) has the molecular formula C15H21Cl2N3OS
and a molecular weight of 362.33 g/mol. Its IUPAC name is N-(2-aminophenyl)-2-(2-tert-butyl-1,3-thiazol-4-yl)acetamide;dihydrochloride.
Molecular Properties
| Compound Name | N-(2-aminophenyl)-2-(2-tert-butyl-1,3-thiazol-4-yl)acetamide;dihydrochloride |
| PubChem CID | 119422829 |
| Molecular Formula | C15H21Cl2N3OS |
| Molecular Weight | 362.33 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | N-(2-aminophenyl)-2-(2-tert-butyl-1,3-thiazol-4-yl)acetamide;dihydrochloride |
| SMILES | CC(C)(C)c1nc(CC(=O)Nc2ccccc2N)cs1.Cl.Cl |
| InChI | InChI=1S/C15H19N3OS.2ClH/c1-15(2,3)14-17-10(9-20-14)8-13(19)18-12-7-5-4-6-11(12)16;;/h4-7,9H,8,16H2,1-3H3,(H,18,19);2*1H |
| InChIKey | PBVIFTLBMLYMKR-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.33 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze N-(2-aminophenyl)-2-(2-tert-butyl-1,3-thiazol-4-yl)acetamide;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-aminophenyl)-2-(2-tert-butyl-1,3-thiazol-4-yl)acetamide;dihydrochloride?
The IUPAC name of N-(2-aminophenyl)-2-(2-tert-butyl-1,3-thiazol-4-yl)acetamide;dihydrochloride (CID 119422829) is N-(2-aminophenyl)-2-(2-tert-butyl-1,3-thiazol-4-yl)acetamide;dihydrochloride.
What is the SMILES notation for N-(2-aminophenyl)-2-(2-tert-butyl-1,3-thiazol-4-yl)acetamide;dihydrochloride?
The canonical SMILES for N-(2-aminophenyl)-2-(2-tert-butyl-1,3-thiazol-4-yl)acetamide;dihydrochloride is CC(C)(C)c1nc(CC(=O)Nc2ccccc2N)cs1.Cl.Cl.
What is the InChIKey of N-(2-aminophenyl)-2-(2-tert-butyl-1,3-thiazol-4-yl)acetamide;dihydrochloride?
The InChIKey is PBVIFTLBMLYMKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3OS.2ClH/c1-15(2,3)14-17-10(9-20-14)8-13(19)18-12-7-5-4-6-11(12)16;;/h4-7,9H,8,16H2,1-3H3,(H,18,19);2*1H.
What are the key properties of N-(2-aminophenyl)-2-(2-tert-butyl-1,3-thiazol-4-yl)acetamide;dihydrochloride?
N-(2-aminophenyl)-2-(2-tert-butyl-1,3-thiazol-4-yl)acetamide;dihydrochloride has a molecular weight of 362.33 g/mol, XLogP of 4.05, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-aminophenyl)-2-(2-tert-butyl-1,3-thiazol-4-yl)acetamide;dihydrochloride is sourced from PubChem (CID 119422829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).