C17H24Cl2N4O3S — CID 119421203
N-[4-[2-(2-amino-5-methoxyanilino)-2-oxoethyl]-1,3-thiazol-2-yl]-2,2-dimethylpropanamide;dihydrochloride (PubChem CID 119421203) has the molecular formula C17H24Cl2N4O3S and a molecular weight of 435.38 g/mol. Its IUPAC name is N-[4-[2-(2-amino-5-methoxyanilino)-2-oxoethyl]-1,3-thiazol-2-yl]-2,2-dimethylpropanamide;dihydrochloride.
| Compound Name | N-[4-[2-(2-amino-5-methoxyanilino)-2-oxoethyl]-1,3-thiazol-2-yl]-2,2-dimethylpropanamide;dihydrochloride |
|---|---|
| PubChem CID | 119421203 |
| Molecular Formula | C17H24Cl2N4O3S |
| Molecular Weight | 435.38 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | N-[4-[2-(2-amino-5-methoxyanilino)-2-oxoethyl]-1,3-thiazol-2-yl]-2,2-dimethylpropanamide;dihydrochloride |
| SMILES | COc1ccc(N)c(NC(=O)Cc2csc(NC(=O)C(C)(C)C)n2)c1.Cl.Cl |
| InChI | InChI=1S/C17H22N4O3S.2ClH/c1-17(2,3)15(23)21-16-19-10(9-25-16)7-14(22)20-13-8-11(24-4)5-6-12(13)18;;/h5-6,8-9H,7,18H2,1-4H3,(H,20,22)(H,19,21,23);2*1H |
| InChIKey | USOURHQVWXDYSZ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.38 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|