C16H20N4O3S — CID 119420969
N-[4-[2-(2-amino-5-methoxyanilino)-2-oxoethyl]-1,3-thiazol-2-yl]-2-methylpropanamide (PubChem CID 119420969) has the molecular formula C16H20N4O3S and a molecular weight of 348.43 g/mol. Its IUPAC name is N-[4-[2-(2-amino-5-methoxyanilino)-2-oxoethyl]-1,3-thiazol-2-yl]-2-methylpropanamide.
| Compound Name | N-[4-[2-(2-amino-5-methoxyanilino)-2-oxoethyl]-1,3-thiazol-2-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 119420969 |
| Molecular Formula | C16H20N4O3S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | N-[4-[2-(2-amino-5-methoxyanilino)-2-oxoethyl]-1,3-thiazol-2-yl]-2-methylpropanamide |
| SMILES | COc1ccc(N)c(NC(=O)Cc2csc(NC(=O)C(C)C)n2)c1 |
| InChI | InChI=1S/C16H20N4O3S/c1-9(2)15(22)20-16-18-10(8-24-16)6-14(21)19-13-7-11(23-3)4-5-12(13)17/h4-5,7-9H,6,17H2,1-3H3,(H,19,21)(H,18,20,22) |
| InChIKey | BWBQCELFBURYKG-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|