C16H18N4O4S — CID 119618303
N-[4-[2-[(6-amino-1,3-benzodioxol-5-yl)amino]-2-oxoethyl]-1,3-thiazol-2-yl]-2-methylpropanamide (PubChem CID 119618303) has the molecular formula C16H18N4O4S and a molecular weight of 362.41 g/mol. Its IUPAC name is N-[4-[2-[(6-amino-1,3-benzodioxol-5-yl)amino]-2-oxoethyl]-1,3-thiazol-2-yl]-2-methylpropanamide.
| Compound Name | N-[4-[2-[(6-amino-1,3-benzodioxol-5-yl)amino]-2-oxoethyl]-1,3-thiazol-2-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 119618303 |
| Molecular Formula | C16H18N4O4S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | N-[4-[2-[(6-amino-1,3-benzodioxol-5-yl)amino]-2-oxoethyl]-1,3-thiazol-2-yl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)Nc1nc(CC(=O)Nc2cc3c(cc2N)OCO3)cs1 |
| InChI | InChI=1S/C16H18N4O4S/c1-8(2)15(22)20-16-18-9(6-25-16)3-14(21)19-11-5-13-12(4-10(11)17)23-7-24-13/h4-6,8H,3,7,17H2,1-2H3,(H,19,21)(H,18,20,22) |
| InChIKey | SXWSVCZSQCRYKF-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 115.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|