C13H18N2O3S — CID 78903050
2-methylprop-2-enyl 2-[2-(2-methylpropanoylamino)-1,3-thiazol-4-yl]acetate (PubChem CID 78903050) has the molecular formula C13H18N2O3S and a molecular weight of 282.37 g/mol. Its IUPAC name is 2-methylprop-2-enyl 2-[2-(2-methylpropanoylamino)-1,3-thiazol-4-yl]acetate.
| Compound Name | 2-methylprop-2-enyl 2-[2-(2-methylpropanoylamino)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 78903050 |
| Molecular Formula | C13H18N2O3S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 2-methylprop-2-enyl 2-[2-(2-methylpropanoylamino)-1,3-thiazol-4-yl]acetate |
| SMILES | C=C(C)COC(=O)Cc1csc(NC(=O)C(C)C)n1 |
| InChI | InChI=1S/C13H18N2O3S/c1-8(2)6-18-11(16)5-10-7-19-13(14-10)15-12(17)9(3)4/h7,9H,1,5-6H2,2-4H3,(H,14,15,17) |
| InChIKey | DNTUDPKURZIJOQ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|