C21H30N4O2S — CID 41160013
N-[4-[2-[4-(diethylamino)-2-methylanilino]-2-oxoethyl]-1,3-thiazol-2-yl]-2,2-dimethylpropanamide (PubChem CID 41160013) has the molecular formula C21H30N4O2S and a molecular weight of 402.56 g/mol. Its IUPAC name is N-[4-[2-[4-(diethylamino)-2-methylanilino]-2-oxoethyl]-1,3-thiazol-2-yl]-2,2-dimethylpropanamide.
| Compound Name | N-[4-[2-[4-(diethylamino)-2-methylanilino]-2-oxoethyl]-1,3-thiazol-2-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 41160013 |
| Molecular Formula | C21H30N4O2S |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | N-[4-[2-[4-(diethylamino)-2-methylanilino]-2-oxoethyl]-1,3-thiazol-2-yl]-2,2-dimethylpropanamide |
| SMILES | CCN(CC)c1ccc(NC(=O)Cc2csc(NC(=O)C(C)(C)C)n2)c(C)c1 |
| InChI | InChI=1S/C21H30N4O2S/c1-7-25(8-2)16-9-10-17(14(3)11-16)23-18(26)12-15-13-28-20(22-15)24-19(27)21(4,5)6/h9-11,13H,7-8,12H2,1-6H3,(H,23,26)(H,22,24,27) |
| InChIKey | YKXCGGPEQAUKHP-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|