C20H23N3O2S — CID 16879558
N-[4-(diethylamino)-2-methylphenyl]-2-(5-thiophen-2-yl-1,2-oxazol-3-yl)acetamide (PubChem CID 16879558) has the molecular formula C20H23N3O2S and a molecular weight of 369.49 g/mol. Its IUPAC name is N-[4-(diethylamino)-2-methylphenyl]-2-(5-thiophen-2-yl-1,2-oxazol-3-yl)acetamide.
| Compound Name | N-[4-(diethylamino)-2-methylphenyl]-2-(5-thiophen-2-yl-1,2-oxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 16879558 |
| Molecular Formula | C20H23N3O2S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | N-[4-(diethylamino)-2-methylphenyl]-2-(5-thiophen-2-yl-1,2-oxazol-3-yl)acetamide |
| SMILES | CCN(CC)c1ccc(NC(=O)Cc2cc(-c3cccs3)on2)c(C)c1 |
| InChI | InChI=1S/C20H23N3O2S/c1-4-23(5-2)16-8-9-17(14(3)11-16)21-20(24)13-15-12-18(25-22-15)19-7-6-10-26-19/h6-12H,4-5,13H2,1-3H3,(H,21,24) |
| InChIKey | MQENZTCVXFOGDZ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|