C16H21Cl2N5O — CID 119424737
1-(3-chlorophenyl)-5-ethyl-N-piperidin-3-yltriazole-4-carboxamide;hydrochloride (PubChem CID 119424737) has the molecular formula C16H21Cl2N5O and a molecular weight of 370.28 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-5-ethyl-N-piperidin-3-yltriazole-4-carboxamide;hydrochloride.
| Compound Name | 1-(3-chlorophenyl)-5-ethyl-N-piperidin-3-yltriazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119424737 |
| Molecular Formula | C16H21Cl2N5O |
| Molecular Weight | 370.28 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | 1-(3-chlorophenyl)-5-ethyl-N-piperidin-3-yltriazole-4-carboxamide;hydrochloride |
| SMILES | CCc1c(C(=O)NC2CCCNC2)nnn1-c1cccc(Cl)c1.Cl |
| InChI | InChI=1S/C16H20ClN5O.ClH/c1-2-14-15(16(23)19-12-6-4-8-18-10-12)20-21-22(14)13-7-3-5-11(17)9-13;/h3,5,7,9,12,18H,2,4,6,8,10H2,1H3,(H,19,23);1H |
| InChIKey | WTWJNSSAKGHPKD-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.28 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |