C12H15ClF3N3O2 — CID 119425759
2-oxo-N-piperidin-3-yl-6-(trifluoromethyl)-1H-pyridine-3-carboxamide;hydrochloride (PubChem CID 119425759) has the molecular formula C12H15ClF3N3O2 and a molecular weight of 325.72 g/mol. Its IUPAC name is 2-oxo-N-piperidin-3-yl-6-(trifluoromethyl)-1H-pyridine-3-carboxamide;hydrochloride.
| Compound Name | 2-oxo-N-piperidin-3-yl-6-(trifluoromethyl)-1H-pyridine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119425759 |
| Molecular Formula | C12H15ClF3N3O2 |
| Molecular Weight | 325.72 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | 2-oxo-N-piperidin-3-yl-6-(trifluoromethyl)-1H-pyridine-3-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NC1CCCNC1)c1ccc(C(F)(F)F)[nH]c1=O |
| InChI | InChI=1S/C12H14F3N3O2.ClH/c13-12(14,15)9-4-3-8(11(20)18-9)10(19)17-7-2-1-5-16-6-7;/h3-4,7,16H,1-2,5-6H2,(H,17,19)(H,18,20);1H |
| InChIKey | UNMIXPGKYUTISE-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.72 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |