C16H18BrN3OS — CID 119428386
2-[2-(3-bromophenyl)-1,3-thiazol-4-yl]-N-piperidin-3-ylacetamide (PubChem CID 119428386) has the molecular formula C16H18BrN3OS and a molecular weight of 380.31 g/mol. Its IUPAC name is 2-[2-(3-bromophenyl)-1,3-thiazol-4-yl]-N-piperidin-3-ylacetamide.
| Compound Name | 2-[2-(3-bromophenyl)-1,3-thiazol-4-yl]-N-piperidin-3-ylacetamide |
|---|---|
| PubChem CID | 119428386 |
| Molecular Formula | C16H18BrN3OS |
| Molecular Weight | 380.31 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | 2-[2-(3-bromophenyl)-1,3-thiazol-4-yl]-N-piperidin-3-ylacetamide |
| SMILES | O=C(Cc1csc(-c2cccc(Br)c2)n1)NC1CCCNC1 |
| InChI | InChI=1S/C16H18BrN3OS/c17-12-4-1-3-11(7-12)16-20-14(10-22-16)8-15(21)19-13-5-2-6-18-9-13/h1,3-4,7,10,13,18H,2,5-6,8-9H2,(H,19,21) |
| InChIKey | ZEYZSNDYDVJWAR-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.31 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |