C17H19BrN2O2 — CID 11943204
[(2R,4S,5S)-5-ethynyl-1-azabicyclo[2.2.2]octan-2-yl]methyl N-(4-bromophenyl)carbamate (PubChem CID 11943204) has the molecular formula C17H19BrN2O2 and a molecular weight of 363.26 g/mol. Its IUPAC name is [(2R,4S,5S)-5-ethynyl-1-azabicyclo[2.2.2]octan-2-yl]methyl N-(4-bromophenyl)carbamate.
| Compound Name | [(2R,4S,5S)-5-ethynyl-1-azabicyclo[2.2.2]octan-2-yl]methyl N-(4-bromophenyl)carbamate |
|---|---|
| PubChem CID | 11943204 |
| Molecular Formula | C17H19BrN2O2 |
| Molecular Weight | 363.26 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | [(2R,4S,5S)-5-ethynyl-1-azabicyclo[2.2.2]octan-2-yl]methyl N-(4-bromophenyl)carbamate |
| SMILES | C#C[C@H]1CN2CC[C@H]1C[C@@H]2COC(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C17H19BrN2O2/c1-2-12-10-20-8-7-13(12)9-16(20)11-22-17(21)19-15-5-3-14(18)4-6-15/h1,3-6,12-13,16H,7-11H2,(H,19,21)/t12-,13-,16+/m0/s1 |
| InChIKey | XLLIDDMPQSGISR-HEHGZKQESA-N |
| XLogP | 3.34 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.26 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|