C18H20F3N2O2+ — CID 11943485
[(2R,4S,5S)-5-ethynyl-1-azoniabicyclo[2.2.2]octan-2-yl]methyl N-[3-(trifluoromethyl)phenyl]carbamate (PubChem CID 11943485) has the molecular formula C18H20F3N2O2+ and a molecular weight of 353.36 g/mol. Its IUPAC name is [(2R,4S,5S)-5-ethynyl-1-azoniabicyclo[2.2.2]octan-2-yl]methyl N-[3-(trifluoromethyl)phenyl]carbamate.
| Compound Name | [(2R,4S,5S)-5-ethynyl-1-azoniabicyclo[2.2.2]octan-2-yl]methyl N-[3-(trifluoromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 11943485 |
| Molecular Formula | C18H20F3N2O2+ |
| Molecular Weight | 353.36 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | [(2R,4S,5S)-5-ethynyl-1-azoniabicyclo[2.2.2]octan-2-yl]methyl N-[3-(trifluoromethyl)phenyl]carbamate |
| SMILES | C#C[C@H]1C[NH+]2CC[C@H]1C[C@@H]2COC(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H19F3N2O2/c1-2-12-10-23-7-6-13(12)8-16(23)11-25-17(24)22-15-5-3-4-14(9-15)18(19,20)21/h1,3-5,9,12-13,16H,6-8,10-11H2,(H,22,24)/p+1/t12-,13-,16+/m0/s1 |
| InChIKey | MLHSCWMZIGULLI-HEHGZKQESA-O |
| XLogP | 2.18 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.36 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|