C17H22BrClN4O2 — CID 119435473
3-[2-[2-(1-aminoethyl)piperidin-1-yl]-2-oxoethyl]-6-bromoquinazolin-4-one;hydrochloride (PubChem CID 119435473) has the molecular formula C17H22BrClN4O2 and a molecular weight of 429.75 g/mol. Its IUPAC name is 3-[2-[2-(1-aminoethyl)piperidin-1-yl]-2-oxoethyl]-6-bromoquinazolin-4-one;hydrochloride.
| Compound Name | 3-[2-[2-(1-aminoethyl)piperidin-1-yl]-2-oxoethyl]-6-bromoquinazolin-4-one;hydrochloride |
|---|---|
| PubChem CID | 119435473 |
| Molecular Formula | C17H22BrClN4O2 |
| Molecular Weight | 429.75 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | 3-[2-[2-(1-aminoethyl)piperidin-1-yl]-2-oxoethyl]-6-bromoquinazolin-4-one;hydrochloride |
| SMILES | CC(N)C1CCCCN1C(=O)Cn1cnc2ccc(Br)cc2c1=O.Cl |
| InChI | InChI=1S/C17H21BrN4O2.ClH/c1-11(19)15-4-2-3-7-22(15)16(23)9-21-10-20-14-6-5-12(18)8-13(14)17(21)24;/h5-6,8,10-11,15H,2-4,7,9,19H2,1H3;1H |
| InChIKey | MGRXGSBVJBFIFT-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.75 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |