C16H20ClN3O2 — CID 119438297
N-[3-(ethylaminomethyl)phenyl]-6-methyl-4-oxo-1H-pyridine-3-carboxamide;hydrochloride (PubChem CID 119438297) has the molecular formula C16H20ClN3O2 and a molecular weight of 321.81 g/mol. Its IUPAC name is N-[3-(ethylaminomethyl)phenyl]-6-methyl-4-oxo-1H-pyridine-3-carboxamide;hydrochloride.
| Compound Name | N-[3-(ethylaminomethyl)phenyl]-6-methyl-4-oxo-1H-pyridine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119438297 |
| Molecular Formula | C16H20ClN3O2 |
| Molecular Weight | 321.81 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | N-[3-(ethylaminomethyl)phenyl]-6-methyl-4-oxo-1H-pyridine-3-carboxamide;hydrochloride |
| SMILES | CCNCc1cccc(NC(=O)c2c[nH]c(C)cc2=O)c1.Cl |
| InChI | InChI=1S/C16H19N3O2.ClH/c1-3-17-9-12-5-4-6-13(8-12)19-16(21)14-10-18-11(2)7-15(14)20;/h4-8,10,17H,3,9H2,1-2H3,(H,18,20)(H,19,21);1H |
| InChIKey | BUGDQTRVCZQJCF-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.81 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |