C17H24N4O — CID 119438538
5-tert-butyl-N-[3-(ethylaminomethyl)phenyl]-1H-pyrazole-3-carboxamide (PubChem CID 119438538) has the molecular formula C17H24N4O and a molecular weight of 300.41 g/mol. Its IUPAC name is 5-tert-butyl-N-[3-(ethylaminomethyl)phenyl]-1H-pyrazole-3-carboxamide.
| Compound Name | 5-tert-butyl-N-[3-(ethylaminomethyl)phenyl]-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 119438538 |
| Molecular Formula | C17H24N4O |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | 5-tert-butyl-N-[3-(ethylaminomethyl)phenyl]-1H-pyrazole-3-carboxamide |
| SMILES | CCNCc1cccc(NC(=O)c2cc(C(C)(C)C)[nH]n2)c1 |
| InChI | InChI=1S/C17H24N4O/c1-5-18-11-12-7-6-8-13(9-12)19-16(22)14-10-15(21-20-14)17(2,3)4/h6-10,18H,5,11H2,1-4H3,(H,19,22)(H,20,21) |
| InChIKey | ZVEZIYILRSTVOR-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |