C18H17N5O2 — CID 167888632
N-[3-[[(5-methyl-1H-pyrazole-3-carbonyl)amino]methyl]phenyl]pyridine-2-carboxamide (PubChem CID 167888632) has the molecular formula C18H17N5O2 and a molecular weight of 335.37 g/mol. Its IUPAC name is N-[3-[[(5-methyl-1H-pyrazole-3-carbonyl)amino]methyl]phenyl]pyridine-2-carboxamide.
| Compound Name | N-[3-[[(5-methyl-1H-pyrazole-3-carbonyl)amino]methyl]phenyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 167888632 |
| Molecular Formula | C18H17N5O2 |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | N-[3-[[(5-methyl-1H-pyrazole-3-carbonyl)amino]methyl]phenyl]pyridine-2-carboxamide |
| SMILES | Cc1cc(C(=O)NCc2cccc(NC(=O)c3ccccn3)c2)n[nH]1 |
| InChI | InChI=1S/C18H17N5O2/c1-12-9-16(23-22-12)17(24)20-11-13-5-4-6-14(10-13)21-18(25)15-7-2-3-8-19-15/h2-10H,11H2,1H3,(H,20,24)(H,21,25)(H,22,23) |
| InChIKey | COBBWNMTUDGBEC-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |