C16H13N5O2S — CID 166190967
N-[[3-(pyridine-2-carbonylamino)phenyl]methyl]thiadiazole-4-carboxamide (PubChem CID 166190967) has the molecular formula C16H13N5O2S and a molecular weight of 339.38 g/mol. Its IUPAC name is N-[[3-(pyridine-2-carbonylamino)phenyl]methyl]thiadiazole-4-carboxamide.
| Compound Name | N-[[3-(pyridine-2-carbonylamino)phenyl]methyl]thiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 166190967 |
| Molecular Formula | C16H13N5O2S |
| Molecular Weight | 339.38 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | N-[[3-(pyridine-2-carbonylamino)phenyl]methyl]thiadiazole-4-carboxamide |
| SMILES | O=C(NCc1cccc(NC(=O)c2ccccn2)c1)c1csnn1 |
| InChI | InChI=1S/C16H13N5O2S/c22-15(14-10-24-21-20-14)18-9-11-4-3-5-12(8-11)19-16(23)13-6-1-2-7-17-13/h1-8,10H,9H2,(H,18,22)(H,19,23) |
| InChIKey | FGYHWZVVGWWGMY-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.38 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |