C20H22N4O3 — CID 119439698
3-(2,4-dioxoquinazolin-1-yl)-N-[2-(ethylaminomethyl)phenyl]propanamide (PubChem CID 119439698) has the molecular formula C20H22N4O3 and a molecular weight of 366.42 g/mol. Its IUPAC name is 3-(2,4-dioxoquinazolin-1-yl)-N-[2-(ethylaminomethyl)phenyl]propanamide.
| Compound Name | 3-(2,4-dioxoquinazolin-1-yl)-N-[2-(ethylaminomethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 119439698 |
| Molecular Formula | C20H22N4O3 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 3-(2,4-dioxoquinazolin-1-yl)-N-[2-(ethylaminomethyl)phenyl]propanamide |
| SMILES | CCNCc1ccccc1NC(=O)CCn1c(=O)[nH]c(=O)c2ccccc21 |
| InChI | InChI=1S/C20H22N4O3/c1-2-21-13-14-7-3-5-9-16(14)22-18(25)11-12-24-17-10-6-4-8-15(17)19(26)23-20(24)27/h3-10,21H,2,11-13H2,1H3,(H,22,25)(H,23,26,27) |
| InChIKey | BYDGBJLTFXITML-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |