C20H23Cl2N3O2 — CID 119439813
1-(3-chlorophenyl)-N-[2-(ethylaminomethyl)phenyl]-2-oxopyrrolidine-3-carboxamide;hydrochloride (PubChem CID 119439813) has the molecular formula C20H23Cl2N3O2 and a molecular weight of 408.33 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N-[2-(ethylaminomethyl)phenyl]-2-oxopyrrolidine-3-carboxamide;hydrochloride.
| Compound Name | 1-(3-chlorophenyl)-N-[2-(ethylaminomethyl)phenyl]-2-oxopyrrolidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119439813 |
| Molecular Formula | C20H23Cl2N3O2 |
| Molecular Weight | 408.33 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | 1-(3-chlorophenyl)-N-[2-(ethylaminomethyl)phenyl]-2-oxopyrrolidine-3-carboxamide;hydrochloride |
| SMILES | CCNCc1ccccc1NC(=O)C1CCN(c2cccc(Cl)c2)C1=O.Cl |
| InChI | InChI=1S/C20H22ClN3O2.ClH/c1-2-22-13-14-6-3-4-9-18(14)23-19(25)17-10-11-24(20(17)26)16-8-5-7-15(21)12-16;/h3-9,12,17,22H,2,10-11,13H2,1H3,(H,23,25);1H |
| InChIKey | NBLLEVKBQMWIEK-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.33 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|