C19H29N3O3S — CID 119442848
3-(cyclopentylsulfamoyl)-N,4-dimethyl-N-piperidin-4-ylbenzamide (PubChem CID 119442848) has the molecular formula C19H29N3O3S and a molecular weight of 379.53 g/mol. Its IUPAC name is 3-(cyclopentylsulfamoyl)-N,4-dimethyl-N-piperidin-4-ylbenzamide.
| Compound Name | 3-(cyclopentylsulfamoyl)-N,4-dimethyl-N-piperidin-4-ylbenzamide |
|---|---|
| PubChem CID | 119442848 |
| Molecular Formula | C19H29N3O3S |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 3-(cyclopentylsulfamoyl)-N,4-dimethyl-N-piperidin-4-ylbenzamide |
| SMILES | Cc1ccc(C(=O)N(C)C2CCNCC2)cc1S(=O)(=O)NC1CCCC1 |
| InChI | InChI=1S/C19H29N3O3S/c1-14-7-8-15(19(23)22(2)17-9-11-20-12-10-17)13-18(14)26(24,25)21-16-5-3-4-6-16/h7-8,13,16-17,20-21H,3-6,9-12H2,1-2H3 |
| InChIKey | ZGDNLSIAEVBBIT-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |