C23H30N2O3S — CID 46771981
N-cyclohexyl-3-[(2,5-dimethylphenyl)sulfamoyl]-N,4-dimethylbenzamide (PubChem CID 46771981) has the molecular formula C23H30N2O3S and a molecular weight of 414.57 g/mol. Its IUPAC name is N-cyclohexyl-3-[(2,5-dimethylphenyl)sulfamoyl]-N,4-dimethylbenzamide.
| Compound Name | N-cyclohexyl-3-[(2,5-dimethylphenyl)sulfamoyl]-N,4-dimethylbenzamide |
|---|---|
| PubChem CID | 46771981 |
| Molecular Formula | C23H30N2O3S |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | N-cyclohexyl-3-[(2,5-dimethylphenyl)sulfamoyl]-N,4-dimethylbenzamide |
| SMILES | Cc1ccc(C)c(NS(=O)(=O)c2cc(C(=O)N(C)C3CCCCC3)ccc2C)c1 |
| InChI | InChI=1S/C23H30N2O3S/c1-16-10-11-17(2)21(14-16)24-29(27,28)22-15-19(13-12-18(22)3)23(26)25(4)20-8-6-5-7-9-20/h10-15,20,24H,5-9H2,1-4H3 |
| InChIKey | NHRCAOYDMWCCFQ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |