C16H25ClN4O2 — CID 119444373
N-methyl-2-[(3-methylphenyl)carbamoylamino]-N-piperidin-4-ylacetamide;hydrochloride (PubChem CID 119444373) has the molecular formula C16H25ClN4O2 and a molecular weight of 340.86 g/mol. Its IUPAC name is N-methyl-2-[(3-methylphenyl)carbamoylamino]-N-piperidin-4-ylacetamide;hydrochloride.
| Compound Name | N-methyl-2-[(3-methylphenyl)carbamoylamino]-N-piperidin-4-ylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119444373 |
| Molecular Formula | C16H25ClN4O2 |
| Molecular Weight | 340.86 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | N-methyl-2-[(3-methylphenyl)carbamoylamino]-N-piperidin-4-ylacetamide;hydrochloride |
| SMILES | Cc1cccc(NC(=O)NCC(=O)N(C)C2CCNCC2)c1.Cl |
| InChI | InChI=1S/C16H24N4O2.ClH/c1-12-4-3-5-13(10-12)19-16(22)18-11-15(21)20(2)14-6-8-17-9-7-14;/h3-5,10,14,17H,6-9,11H2,1-2H3,(H2,18,19,22);1H |
| InChIKey | UKTRVPREOBCQAC-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.86 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |