C32H26N4O8 — CID 11944831
(2R,6R,7R,9S,13S,14S)-7,14-bis(furan-2-yl)-4,11-bis(2-methoxyphenyl)-1,4,8,11-tetrazatetracyclo[6.6.0.02,6.09,13]tetradecane-3,5,10,12-tetrone (PubChem CID 11944831) has the molecular formula C32H26N4O8 and a molecular weight of 594.58 g/mol. Its IUPAC name is (2R,6R,7R,9S,13S,14S)-7,14-bis(furan-2-yl)-4,11-bis(2-methoxyphenyl)-1,4,8,11-tetrazatetracyclo[6.6.0.02,6.09,13]tetradecane-3,5,10,12-tetrone.
| Compound Name | (2R,6R,7R,9S,13S,14S)-7,14-bis(furan-2-yl)-4,11-bis(2-methoxyphenyl)-1,4,8,11-tetrazatetracyclo[6.6.0.02,6.09,13]tetradecane-3,5,10,12-tetrone |
|---|---|
| PubChem CID | 11944831 |
| Molecular Formula | C32H26N4O8 |
| Molecular Weight | 594.58 g/mol |
| Exact Mass | 594.18 |
| IUPAC Name | (2R,6R,7R,9S,13S,14S)-7,14-bis(furan-2-yl)-4,11-bis(2-methoxyphenyl)-1,4,8,11-tetrazatetracyclo[6.6.0.02,6.09,13]tetradecane-3,5,10,12-tetrone |
| SMILES | COc1ccccc1N1C(=O)[C@@H]2[C@@H](C1=O)N1[C@@H](c3ccco3)[C@H]3C(=O)N(c4ccccc4OC)C(=O)[C@@H]3N1[C@@H]2c1ccco1 |
| InChI | InChI=1S/C32H26N4O8/c1-41-19-11-5-3-9-17(19)33-29(37)23-25(21-13-7-15-43-21)36-28-24(26(22-14-8-16-44-22)35(36)27(23)31(33)39)30(38)34(32(28)40)18-10-4-6-12-20(18)42-2/h3-16,23-28H,1-2H3/t23-,24+,25+,26-,27-,28+ |
| InChIKey | PYQSMNSSVLWBTE-BYECRERDSA-N |
| XLogP | 3.33 |
| TPSA | 125.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.58 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|