C12H13N5OS — CID 119449848
2-pyrimidin-2-yl-N-pyrrolidin-3-yl-1,3-thiazole-5-carboxamide (PubChem CID 119449848) has the molecular formula C12H13N5OS and a molecular weight of 275.34 g/mol. Its IUPAC name is 2-pyrimidin-2-yl-N-pyrrolidin-3-yl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-pyrimidin-2-yl-N-pyrrolidin-3-yl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 119449848 |
| Molecular Formula | C12H13N5OS |
| Molecular Weight | 275.34 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 2-pyrimidin-2-yl-N-pyrrolidin-3-yl-1,3-thiazole-5-carboxamide |
| SMILES | O=C(NC1CCNC1)c1cnc(-c2ncccn2)s1 |
| InChI | InChI=1S/C12H13N5OS/c18-11(17-8-2-5-13-6-8)9-7-16-12(19-9)10-14-3-1-4-15-10/h1,3-4,7-8,13H,2,5-6H2,(H,17,18) |
| InChIKey | UYRJEBMHPWQKIU-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.34 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |