C7H10N4OS — CID 79685297
N-[(3R)-pyrrolidin-3-yl]-1,2,5-thiadiazole-3-carboxamide (PubChem CID 79685297) has the molecular formula C7H10N4OS and a molecular weight of 198.25 g/mol. Its IUPAC name is N-[(3R)-pyrrolidin-3-yl]-1,2,5-thiadiazole-3-carboxamide.
| Compound Name | N-[(3R)-pyrrolidin-3-yl]-1,2,5-thiadiazole-3-carboxamide |
|---|---|
| PubChem CID | 79685297 |
| Molecular Formula | C7H10N4OS |
| Molecular Weight | 198.25 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | N-[(3R)-pyrrolidin-3-yl]-1,2,5-thiadiazole-3-carboxamide |
| SMILES | O=C(N[C@@H]1CCNC1)c1cnsn1 |
| InChI | InChI=1S/C7H10N4OS/c12-7(6-4-9-13-11-6)10-5-1-2-8-3-5/h4-5,8H,1-3H2,(H,10,12)/t5-/m1/s1 |
| InChIKey | WIAJVTVUEZCZNH-RXMQYKEDSA-N |
| XLogP | -0.37 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.25 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |