C6H7N3OS — CID 60858227
N-cyclopropyl-1,2,5-thiadiazole-3-carboxamide (PubChem CID 60858227) has the molecular formula C6H7N3OS and a molecular weight of 169.21 g/mol. Its IUPAC name is N-cyclopropyl-1,2,5-thiadiazole-3-carboxamide.
| Compound Name | N-cyclopropyl-1,2,5-thiadiazole-3-carboxamide |
|---|---|
| PubChem CID | 60858227 |
| Molecular Formula | C6H7N3OS |
| Molecular Weight | 169.21 g/mol |
| Exact Mass | 169.03 |
| IUPAC Name | N-cyclopropyl-1,2,5-thiadiazole-3-carboxamide |
| SMILES | O=C(NC1CC1)c1cnsn1 |
| InChI | InChI=1S/C6H7N3OS/c10-6(8-4-1-2-4)5-3-7-11-9-5/h3-4H,1-2H2,(H,8,10) |
| InChIKey | IMZDVFQZJSGYFW-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.21 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |