C11H17N3OS — CID 47338961
N-(2-cyclohexylethyl)-1,2,5-thiadiazole-3-carboxamide (PubChem CID 47338961) has the molecular formula C11H17N3OS and a molecular weight of 239.34 g/mol. Its IUPAC name is N-(2-cyclohexylethyl)-1,2,5-thiadiazole-3-carboxamide.
| Compound Name | N-(2-cyclohexylethyl)-1,2,5-thiadiazole-3-carboxamide |
|---|---|
| PubChem CID | 47338961 |
| Molecular Formula | C11H17N3OS |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | N-(2-cyclohexylethyl)-1,2,5-thiadiazole-3-carboxamide |
| SMILES | O=C(NCCC1CCCCC1)c1cnsn1 |
| InChI | InChI=1S/C11H17N3OS/c15-11(10-8-13-16-14-10)12-7-6-9-4-2-1-3-5-9/h8-9H,1-7H2,(H,12,15) |
| InChIKey | CGLQCPUSNSFUKI-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |