C15H23N3O3S2 — CID 119449859
5-(4-methylpiperidin-1-yl)sulfonyl-N-pyrrolidin-3-ylthiophene-2-carboxamide (PubChem CID 119449859) has the molecular formula C15H23N3O3S2 and a molecular weight of 357.50 g/mol. Its IUPAC name is 5-(4-methylpiperidin-1-yl)sulfonyl-N-pyrrolidin-3-ylthiophene-2-carboxamide.
| Compound Name | 5-(4-methylpiperidin-1-yl)sulfonyl-N-pyrrolidin-3-ylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 119449859 |
| Molecular Formula | C15H23N3O3S2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 5-(4-methylpiperidin-1-yl)sulfonyl-N-pyrrolidin-3-ylthiophene-2-carboxamide |
| SMILES | CC1CCN(S(=O)(=O)c2ccc(C(=O)NC3CCNC3)s2)CC1 |
| InChI | InChI=1S/C15H23N3O3S2/c1-11-5-8-18(9-6-11)23(20,21)14-3-2-13(22-14)15(19)17-12-4-7-16-10-12/h2-3,11-12,16H,4-10H2,1H3,(H,17,19) |
| InChIKey | BDCCBQWWBHFODM-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |