C13H12Br2N2O2 — CID 119451100
5,7-dibromo-N-pyrrolidin-3-yl-1-benzofuran-2-carboxamide (PubChem CID 119451100) has the molecular formula C13H12Br2N2O2 and a molecular weight of 388.06 g/mol. Its IUPAC name is 5,7-dibromo-N-pyrrolidin-3-yl-1-benzofuran-2-carboxamide.
| Compound Name | 5,7-dibromo-N-pyrrolidin-3-yl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 119451100 |
| Molecular Formula | C13H12Br2N2O2 |
| Molecular Weight | 388.06 g/mol |
| Exact Mass | 385.93 |
| IUPAC Name | 5,7-dibromo-N-pyrrolidin-3-yl-1-benzofuran-2-carboxamide |
| SMILES | O=C(NC1CCNC1)c1cc2cc(Br)cc(Br)c2o1 |
| InChI | InChI=1S/C13H12Br2N2O2/c14-8-3-7-4-11(19-12(7)10(15)5-8)13(18)17-9-1-2-16-6-9/h3-5,9,16H,1-2,6H2,(H,17,18) |
| InChIKey | ZNIOSJGTVBLAKC-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.06 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |