C9H3Br2O3- — CID 7062553
5,7-dibromo-1-benzofuran-2-carboxylate (PubChem CID 7062553) has the molecular formula C9H3Br2O3- and a molecular weight of 318.93 g/mol. Its IUPAC name is 5,7-dibromo-1-benzofuran-2-carboxylate.
| Compound Name | 5,7-dibromo-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 7062553 |
| Molecular Formula | C9H3Br2O3- |
| Molecular Weight | 318.93 g/mol |
| Exact Mass | 316.85 |
| IUPAC Name | 5,7-dibromo-1-benzofuran-2-carboxylate |
| SMILES | O=C([O-])c1cc2cc(Br)cc(Br)c2o1 |
| InChI | InChI=1S/C9H4Br2O3/c10-5-1-4-2-7(9(12)13)14-8(4)6(11)3-5/h1-3H,(H,12,13)/p-1 |
| InChIKey | PTCVMMBMRYJVFE-UHFFFAOYSA-M |
| XLogP | 2.32 |
| TPSA | 53.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.93 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |