C13H19BrClN3O3S — CID 119454444
3-bromo-4-(dimethylsulfamoyl)-N-pyrrolidin-3-ylbenzamide;hydrochloride (PubChem CID 119454444) has the molecular formula C13H19BrClN3O3S and a molecular weight of 412.74 g/mol. Its IUPAC name is 3-bromo-4-(dimethylsulfamoyl)-N-pyrrolidin-3-ylbenzamide;hydrochloride.
| Compound Name | 3-bromo-4-(dimethylsulfamoyl)-N-pyrrolidin-3-ylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 119454444 |
| Molecular Formula | C13H19BrClN3O3S |
| Molecular Weight | 412.74 g/mol |
| Exact Mass | 411.00 |
| IUPAC Name | 3-bromo-4-(dimethylsulfamoyl)-N-pyrrolidin-3-ylbenzamide;hydrochloride |
| SMILES | CN(C)S(=O)(=O)c1ccc(C(=O)NC2CCNC2)cc1Br.Cl |
| InChI | InChI=1S/C13H18BrN3O3S.ClH/c1-17(2)21(19,20)12-4-3-9(7-11(12)14)13(18)16-10-5-6-15-8-10;/h3-4,7,10,15H,5-6,8H2,1-2H3,(H,16,18);1H |
| InChIKey | VVJZTWTVFXGYKA-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.74 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |