C14H18ClFN4O4 — CID 119454706
3-fluoro-N-methyl-5-nitro-N-(2-oxo-2-piperazin-1-ylethyl)benzamide;hydrochloride (PubChem CID 119454706) has the molecular formula C14H18ClFN4O4 and a molecular weight of 360.77 g/mol. Its IUPAC name is 3-fluoro-N-methyl-5-nitro-N-(2-oxo-2-piperazin-1-ylethyl)benzamide;hydrochloride.
| Compound Name | 3-fluoro-N-methyl-5-nitro-N-(2-oxo-2-piperazin-1-ylethyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119454706 |
| Molecular Formula | C14H18ClFN4O4 |
| Molecular Weight | 360.77 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | 3-fluoro-N-methyl-5-nitro-N-(2-oxo-2-piperazin-1-ylethyl)benzamide;hydrochloride |
| SMILES | CN(CC(=O)N1CCNCC1)C(=O)c1cc(F)cc([N+](=O)[O-])c1.Cl |
| InChI | InChI=1S/C14H17FN4O4.ClH/c1-17(9-13(20)18-4-2-16-3-5-18)14(21)10-6-11(15)8-12(7-10)19(22)23;/h6-8,16H,2-5,9H2,1H3;1H |
| InChIKey | VQQPTFPRZQGQEP-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.77 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|