C16H19ClN4O — CID 119467359
[2-(aminomethyl)piperidin-1-yl]-[1-(3-chlorophenyl)pyrazol-3-yl]methanone (PubChem CID 119467359) has the molecular formula C16H19ClN4O and a molecular weight of 318.81 g/mol. Its IUPAC name is [2-(aminomethyl)piperidin-1-yl]-[1-(3-chlorophenyl)pyrazol-3-yl]methanone.
| Compound Name | [2-(aminomethyl)piperidin-1-yl]-[1-(3-chlorophenyl)pyrazol-3-yl]methanone |
|---|---|
| PubChem CID | 119467359 |
| Molecular Formula | C16H19ClN4O |
| Molecular Weight | 318.81 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | [2-(aminomethyl)piperidin-1-yl]-[1-(3-chlorophenyl)pyrazol-3-yl]methanone |
| SMILES | NCC1CCCCN1C(=O)c1ccn(-c2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C16H19ClN4O/c17-12-4-3-6-13(10-12)21-9-7-15(19-21)16(22)20-8-2-1-5-14(20)11-18/h3-4,6-7,9-10,14H,1-2,5,8,11,18H2 |
| InChIKey | QFTWUNWUDBSVDF-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.81 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |